C28H40O5 — CID 90415784
4-methylheptane-3,5-diol;(2,4,6-trimethylphenyl) 2-oxo-2-(2,4,6-trimethylphenyl)acetate (PubChem CID 90415784) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is 4-methylheptane-3,5-diol;(2,4,6-trimethylphenyl) 2-oxo-2-(2,4,6-trimethylphenyl)acetate.
| Compound Name | 4-methylheptane-3,5-diol;(2,4,6-trimethylphenyl) 2-oxo-2-(2,4,6-trimethylphenyl)acetate |
|---|---|
| PubChem CID | 90415784 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 4-methylheptane-3,5-diol;(2,4,6-trimethylphenyl) 2-oxo-2-(2,4,6-trimethylphenyl)acetate |
| SMILES | CCC(O)C(C)C(O)CC.Cc1cc(C)c(OC(=O)C(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C20H22O3.C8H18O2/c1-11-7-13(3)17(14(4)8-11)18(21)20(22)23-19-15(5)9-12(2)10-16(19)6;1-4-7(9)6(3)8(10)5-2/h7-10H,1-6H3;6-10H,4-5H2,1-3H3 |
| InChIKey | LREWDOYNSPQLPV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|