C19H27ClN2O3 — CID 90422960
butyl N-[1-[3-chloro-4-(cyclopentylcarbamoyl)phenyl]ethyl]carbamate (PubChem CID 90422960) has the molecular formula C19H27ClN2O3 and a molecular weight of 366.89 g/mol. Its IUPAC name is butyl N-[1-[3-chloro-4-(cyclopentylcarbamoyl)phenyl]ethyl]carbamate.
| Compound Name | butyl N-[1-[3-chloro-4-(cyclopentylcarbamoyl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 90422960 |
| Molecular Formula | C19H27ClN2O3 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | butyl N-[1-[3-chloro-4-(cyclopentylcarbamoyl)phenyl]ethyl]carbamate |
| SMILES | CCCCOC(=O)NC(C)c1ccc(C(=O)NC2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C19H27ClN2O3/c1-3-4-11-25-19(24)21-13(2)14-9-10-16(17(20)12-14)18(23)22-15-7-5-6-8-15/h9-10,12-13,15H,3-8,11H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | RFRAGJXOGKCZEB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|