C28H43NO7 — CID 90429382
4-[(E)-7-[(6E)-4-hydroxy-5-methoxy-3,10-dimethyl-12-oxo-1-oxacyclododec-6-en-2-yl]-5-methyl-4-oxooct-6-enyl]piperidine-2,6-dione (PubChem CID 90429382) has the molecular formula C28H43NO7 and a molecular weight of 505.65 g/mol. Its IUPAC name is 4-[(E)-7-[(6E)-4-hydroxy-5-methoxy-3,10-dimethyl-12-oxo-1-oxacyclododec-6-en-2-yl]-5-methyl-4-oxooct-6-enyl]piperidine-2,6-dione.
| Compound Name | 4-[(E)-7-[(6E)-4-hydroxy-5-methoxy-3,10-dimethyl-12-oxo-1-oxacyclododec-6-en-2-yl]-5-methyl-4-oxooct-6-enyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 90429382 |
| Molecular Formula | C28H43NO7 |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | 4-[(E)-7-[(6E)-4-hydroxy-5-methoxy-3,10-dimethyl-12-oxo-1-oxacyclododec-6-en-2-yl]-5-methyl-4-oxooct-6-enyl]piperidine-2,6-dione |
| SMILES | COC1/C=C/CCC(C)CC(=O)OC(/C(C)=C/C(C)C(=O)CCCC2CC(=O)NC(=O)C2)C(C)C1O |
| InChI | InChI=1S/C28H43NO7/c1-17-9-6-7-12-23(35-5)27(34)20(4)28(36-26(33)13-17)19(3)14-18(2)22(30)11-8-10-21-15-24(31)29-25(32)16-21/h7,12,14,17-18,20-21,23,27-28,34H,6,8-11,13,15-16H2,1-5H3,(H,29,31,32)/b12-7+,19-14+ |
| InChIKey | XTQGOIWTFVAFFK-DXGLHLNISA-N |
| XLogP | 3.66 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|