C22H20FN3O3S — CID 90430781
4-[4-[(2S)-2-[[(1R,2R,4S,5S,7S)-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]-2-cyanoethyl]-3-fluorophenyl]thiophene-2-carboxylic acid (PubChem CID 90430781) has the molecular formula C22H20FN3O3S and a molecular weight of 425.49 g/mol. Its IUPAC name is 4-[4-[(2S)-2-[[(1R,2R,4S,5S,7S)-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]-2-cyanoethyl]-3-fluorophenyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[4-[(2S)-2-[[(1R,2R,4S,5S,7S)-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]-2-cyanoethyl]-3-fluorophenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 90430781 |
| Molecular Formula | C22H20FN3O3S |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 4-[4-[(2S)-2-[[(1R,2R,4S,5S,7S)-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]-2-cyanoethyl]-3-fluorophenyl]thiophene-2-carboxylic acid |
| SMILES | N#C[C@H](Cc1ccc(-c2csc(C(=O)O)c2)cc1F)NC(=O)[C@H]1N[C@H]2C[C@@H]1[C@@H]1C[C@@H]12 |
| InChI | InChI=1S/C22H20FN3O3S/c23-17-4-10(12-5-19(22(28)29)30-9-12)1-2-11(17)3-13(8-24)25-21(27)20-16-7-18(26-20)15-6-14(15)16/h1-2,4-5,9,13-16,18,20,26H,3,6-7H2,(H,25,27)(H,28,29)/t13-,14+,15-,16+,18-,20-/m0/s1 |
| InChIKey | KDKGBLTUQQGQOJ-SHIIKYBRSA-N |
| XLogP | 2.80 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |