C23H22FN3O3S — CID 90440143
methyl 4-[4-[(2S)-2-[[(1R,2R,4S,5S,7S)-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]-2-cyanoethyl]-3-fluorophenyl]thiophene-2-carboxylate (PubChem CID 90440143) has the molecular formula C23H22FN3O3S and a molecular weight of 439.51 g/mol. Its IUPAC name is methyl 4-[4-[(2S)-2-[[(1R,2R,4S,5S,7S)-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]-2-cyanoethyl]-3-fluorophenyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-[4-[(2S)-2-[[(1R,2R,4S,5S,7S)-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]-2-cyanoethyl]-3-fluorophenyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 90440143 |
| Molecular Formula | C23H22FN3O3S |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | methyl 4-[4-[(2S)-2-[[(1R,2R,4S,5S,7S)-6-azatricyclo[3.2.1.02,4]octane-7-carbonyl]amino]-2-cyanoethyl]-3-fluorophenyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(C[C@@H](C#N)NC(=O)[C@H]3N[C@H]4C[C@@H]3[C@@H]3C[C@@H]34)c(F)c2)cs1 |
| InChI | InChI=1S/C23H22FN3O3S/c1-30-23(29)20-6-13(10-31-20)11-2-3-12(18(24)5-11)4-14(9-25)26-22(28)21-17-8-19(27-21)16-7-15(16)17/h2-3,5-6,10,14-17,19,21,27H,4,7-8H2,1H3,(H,26,28)/t14-,15+,16-,17+,19-,21-/m0/s1 |
| InChIKey | YCGQHGQZFQYOAZ-TXQSJXHQSA-N |
| XLogP | 2.89 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |