C56H60BFN11O5S — CID 90431739
CID 90431739 (PubChem CID 90431739) has the molecular formula C56H60BFN11O5S and a molecular weight of 1029.05 g/mol.
| Compound Name | CID 90431739 |
|---|---|
| PubChem CID | 90431739 |
| Molecular Formula | C56H60BFN11O5S |
| Molecular Weight | 1029.05 g/mol |
| Exact Mass | 1028.46 |
| IUPAC Name | — |
| SMILES | CN1C(=O)c2ccccc2N(C)C2N=C(Nc3ccc(C(=O)N4CCC(N5CCN(C(=O)CCCCCNC(=O)COc6ccc(C7=N/C(=C\c8ccc(-c9cccs9)n8[B]F)C=C7)cc6)CC5)CC4)cc3)NC=C21 |
| InChI | InChI=1S/C56H60BFN11O5S/c1-64-47-10-6-5-9-45(47)55(73)65(2)49-36-60-56(63-53(49)64)62-40-17-13-39(14-18-40)54(72)68-28-25-42(26-29-68)66-30-32-67(33-31-66)52(71)12-4-3-7-27-59-51(70)37-74-44-21-15-38(16-22-44)46-23-19-41(61-46)35-43-20-24-48(69(43)57-58)50-11-8-34-75-50/h5-6,8-11,13-24,34-36,42,53H,3-4,7,12,25-33,37H2,1-2H3,(H,59,70)(H2,60,62,63)/b41-35- |
| InChIKey | OIUKPMAZPMWMLX-LCNSVZBRSA-N |
| XLogP | 7.23 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1029.05 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|