About CID 90431739
CID 90431739 (PubChem CID 90431739) has the molecular formula C56H60BFN11O5S
and a molecular weight of 1029.05 g/mol.
Molecular Properties
| Compound Name | CID 90431739 |
| PubChem CID | 90431739 |
| Molecular Formula | C56H60BFN11O5S |
| Molecular Weight | 1029.05 g/mol |
| Exact Mass | 1028.46 |
| IUPAC Name | — |
| SMILES | CN1C(=O)c2ccccc2N(C)C2N=C(Nc3ccc(C(=O)N4CCC(N5CCN(C(=O)CCCCCNC(=O)COc6ccc(C7=N/C(=C\c8ccc(-c9cccs9)n8[B]F)C=C7)cc6)CC5)CC4)cc3)NC=C21 |
| InChI | InChI=1S/C56H60BFN11O5S/c1-64-47-10-6-5-9-45(47)55(73)65(2)49-36-60-56(63-53(49)64)62-40-17-13-39(14-18-40)54(72)68-28-25-42(26-29-68)66-30-32-67(33-31-66)52(71)12-4-3-7-27-59-51(70)37-74-44-21-15-38(16-22-44)46-23-19-41(61-46)35-43-20-24-48(69(43)57-58)50-11-8-34-75-50/h5-6,8-11,13-24,34-36,42,53H,3-4,7,12,25-33,37H2,1-2H3,(H,59,70)(H2,60,62,63)/b41-35- |
| InChIKey | OIUKPMAZPMWMLX-LCNSVZBRSA-N |
| XLogP | 7.23 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 75 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1029.05 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 90431739 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90431739?
The IUPAC name of CID 90431739 (CID 90431739) is not available.
What is the SMILES notation for CID 90431739?
The canonical SMILES for CID 90431739 is CN1C(=O)c2ccccc2N(C)C2N=C(Nc3ccc(C(=O)N4CCC(N5CCN(C(=O)CCCCCNC(=O)COc6ccc(C7=N/C(=C\c8ccc(-c9cccs9)n8[B]F)C=C7)cc6)CC5)CC4)cc3)NC=C21.
What is the InChIKey of CID 90431739?
The InChIKey is OIUKPMAZPMWMLX-LCNSVZBRSA-N. The full InChI is InChI=1S/C56H60BFN11O5S/c1-64-47-10-6-5-9-45(47)55(73)65(2)49-36-60-56(63-53(49)64)62-40-17-13-39(14-18-40)54(72)68-28-25-42(26-29-68)66-30-32-67(33-31-66)52(71)12-4-3-7-27-59-51(70)37-74-44-21-15-38(16-22-44)46-23-19-41(61-46)35-43-20-24-48(69(43)57-58)50-11-8-34-75-50/h5-6,8-11,13-24,34-36,42,53H,3-4,7,12,25-33,37H2,1-2H3,(H,59,70)(H2,60,62,63)/b41-35-.
What are the key properties of CID 90431739?
CID 90431739 has a molecular weight of 1029.05 g/mol, XLogP of 7.23, 16 rotatable bonds, 3 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90431739 is sourced from PubChem (CID 90431739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).