C10H10N4O2S — CID 90436738
4-acetamido-3-aminothieno[2,3-b]pyridine-2-carboxamide (PubChem CID 90436738) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is 4-acetamido-3-aminothieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 4-acetamido-3-aminothieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90436738 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 4-acetamido-3-aminothieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CC(=O)Nc1ccnc2sc(C(N)=O)c(N)c12 |
| InChI | InChI=1S/C10H10N4O2S/c1-4(15)14-5-2-3-13-10-6(5)7(11)8(17-10)9(12)16/h2-3H,11H2,1H3,(H2,12,16)(H,13,14,15) |
| InChIKey | ZONVBCIPSQYGCL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |