C10H10N2OS — CID 82395893
1-(3-amino-4-methylthieno[2,3-b]pyridin-2-yl)ethanone (PubChem CID 82395893) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 1-(3-amino-4-methylthieno[2,3-b]pyridin-2-yl)ethanone.
| Compound Name | 1-(3-amino-4-methylthieno[2,3-b]pyridin-2-yl)ethanone |
|---|---|
| PubChem CID | 82395893 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 1-(3-amino-4-methylthieno[2,3-b]pyridin-2-yl)ethanone |
| SMILES | CC(=O)c1sc2nccc(C)c2c1N |
| InChI | InChI=1S/C10H10N2OS/c1-5-3-4-12-10-7(5)8(11)9(14-10)6(2)13/h3-4H,11H2,1-2H3 |
| InChIKey | BFMMSPGDQWXCHL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |