C12H12F3N3OS2 — CID 106433622
3-amino-4-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 106433622) has the molecular formula C12H12F3N3OS2 and a molecular weight of 335.38 g/mol. Its IUPAC name is 3-amino-4-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-4-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106433622 |
| Molecular Formula | C12H12F3N3OS2 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 3-amino-4-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccnc2sc(C(=O)NCCSC(F)(F)F)c(N)c12 |
| InChI | InChI=1S/C12H12F3N3OS2/c1-6-2-3-18-11-7(6)8(16)9(21-11)10(19)17-4-5-20-12(13,14)15/h2-3H,4-5,16H2,1H3,(H,17,19) |
| InChIKey | QLWNSQKYVOTARE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|