C16H23N3OS — CID 115327426
3-amino-4-methyl-N-(5-methylhexyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 115327426) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is 3-amino-4-methyl-N-(5-methylhexyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-4-methyl-N-(5-methylhexyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 115327426 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 3-amino-4-methyl-N-(5-methylhexyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccnc2sc(C(=O)NCCCCC(C)C)c(N)c12 |
| InChI | InChI=1S/C16H23N3OS/c1-10(2)6-4-5-8-18-15(20)14-13(17)12-11(3)7-9-19-16(12)21-14/h7,9-10H,4-6,8,17H2,1-3H3,(H,18,20) |
| InChIKey | GVZSXYOAYCWCHE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|