C26H34N6O2 — CID 90443908
N-[4-(3-butyl-7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyrimidin-2-amine (PubChem CID 90443908) has the molecular formula C26H34N6O2 and a molecular weight of 462.60 g/mol. Its IUPAC name is N-[4-(3-butyl-7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyrimidin-2-amine.
| Compound Name | N-[4-(3-butyl-7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 90443908 |
| Molecular Formula | C26H34N6O2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | N-[4-(3-butyl-7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyrimidin-2-amine |
| SMILES | CCCCc1cnc2cc(N3CCOCC3)cc(OC3CCC(Nc4ncccn4)CC3)c2n1 |
| InChI | InChI=1S/C26H34N6O2/c1-2-3-5-20-18-29-23-16-21(32-12-14-33-15-13-32)17-24(25(23)30-20)34-22-8-6-19(7-9-22)31-26-27-10-4-11-28-26/h4,10-11,16-19,22H,2-3,5-9,12-15H2,1H3,(H,27,28,31) |
| InChIKey | MEQFVZHXHFJCAJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |