C17H13F3N3OPS — CID 90448889
2-phosphanyl-N-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide (PubChem CID 90448889) has the molecular formula C17H13F3N3OPS and a molecular weight of 395.35 g/mol. Its IUPAC name is 2-phosphanyl-N-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide.
| Compound Name | 2-phosphanyl-N-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 90448889 |
| Molecular Formula | C17H13F3N3OPS |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 2-phosphanyl-N-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ncc(Cc2ccc(C(F)(F)F)cc2)s1)c1ccnc(P)c1 |
| InChI | InChI=1S/C17H13F3N3OPS/c18-17(19,20)12-3-1-10(2-4-12)7-13-9-22-16(26-13)23-15(24)11-5-6-21-14(25)8-11/h1-6,8-9H,7,25H2,(H,22,23,24) |
| InChIKey | GFOSMUJSQSGGHZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|