C24H17N3O3S — CID 90452929
4-methyl-5-[(Z)-[2-oxo-5-(2-phenyl-1,3-thiazol-4-yl)-1H-indol-3-ylidene]methyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 90452929) has the molecular formula C24H17N3O3S and a molecular weight of 427.49 g/mol. Its IUPAC name is 4-methyl-5-[(Z)-[2-oxo-5-(2-phenyl-1,3-thiazol-4-yl)-1H-indol-3-ylidene]methyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-methyl-5-[(Z)-[2-oxo-5-(2-phenyl-1,3-thiazol-4-yl)-1H-indol-3-ylidene]methyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 90452929 |
| Molecular Formula | C24H17N3O3S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 4-methyl-5-[(Z)-[2-oxo-5-(2-phenyl-1,3-thiazol-4-yl)-1H-indol-3-ylidene]methyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)[nH]c1/C=C1\C(=O)Nc2ccc(-c3csc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C24H17N3O3S/c1-13-9-20(24(29)30)25-19(13)11-17-16-10-15(7-8-18(16)26-22(17)28)21-12-31-23(27-21)14-5-3-2-4-6-14/h2-12,25H,1H3,(H,26,28)(H,29,30)/b17-11- |
| InChIKey | GZHPJDYWXPMBKC-BOPFTXTBSA-N |
| XLogP | 5.30 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|