C21H24N2O3 — CID 90453587
2-[2-(3-benzoylphenyl)ethyl]-4-methylpentanediamide (PubChem CID 90453587) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-[2-(3-benzoylphenyl)ethyl]-4-methylpentanediamide.
| Compound Name | 2-[2-(3-benzoylphenyl)ethyl]-4-methylpentanediamide |
|---|---|
| PubChem CID | 90453587 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-[2-(3-benzoylphenyl)ethyl]-4-methylpentanediamide |
| SMILES | CC(CC(CCc1cccc(C(=O)c2ccccc2)c1)C(N)=O)C(N)=O |
| InChI | InChI=1S/C21H24N2O3/c1-14(20(22)25)12-18(21(23)26)11-10-15-6-5-9-17(13-15)19(24)16-7-3-2-4-8-16/h2-9,13-14,18H,10-12H2,1H3,(H2,22,25)(H2,23,26) |
| InChIKey | KRNTZLRFDSWDSQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |