C9H20N2O — CID 90453891
(E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine (PubChem CID 90453891) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine.
| Compound Name | (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine |
|---|---|
| PubChem CID | 90453891 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine |
| SMILES | C/C=C/C(NC)N[C@H](C)COC |
| InChI | InChI=1S/C9H20N2O/c1-5-6-9(10-3)11-8(2)7-12-4/h5-6,8-11H,7H2,1-4H3/b6-5+/t8-,9?/m1/s1 |
| InChIKey | AINAEQFDAPKQDP-SPJCODMASA-N |
| XLogP | 0.73 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|