About (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine
(E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine (PubChem CID 90453891) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine.
Molecular Properties
| Compound Name | (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine |
| PubChem CID | 90453891 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine |
| SMILES | C/C=C/C(NC)N[C@H](C)COC |
| InChI | InChI=1S/C9H20N2O/c1-5-6-9(10-3)11-8(2)7-12-4/h5-6,8-11H,7H2,1-4H3/b6-5+/t8-,9?/m1/s1 |
| InChIKey | AINAEQFDAPKQDP-SPJCODMASA-N |
| XLogP | 0.73 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine?
The IUPAC name of (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine (CID 90453891) is (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine.
What is the SMILES notation for (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine?
The canonical SMILES for (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine is C/C=C/C(NC)N[C@H](C)COC.
What is the InChIKey of (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine?
The InChIKey is AINAEQFDAPKQDP-SPJCODMASA-N. The full InChI is InChI=1S/C9H20N2O/c1-5-6-9(10-3)11-8(2)7-12-4/h5-6,8-11H,7H2,1-4H3/b6-5+/t8-,9?/m1/s1.
What are the key properties of (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine?
(E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine has a molecular weight of 172.27 g/mol, XLogP of 0.73, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-N'-[(2R)-1-methoxypropan-2-yl]-1-N-methylbut-2-ene-1,1-diamine is sourced from PubChem (CID 90453891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).