C21H18O5 — CID 90455248
methyl 4-[(1E,4E)-5-[4-(2-hydroxyacetyl)phenyl]-3-oxopenta-1,4-dienyl]benzoate (PubChem CID 90455248) has the molecular formula C21H18O5 and a molecular weight of 350.37 g/mol. Its IUPAC name is methyl 4-[(1E,4E)-5-[4-(2-hydroxyacetyl)phenyl]-3-oxopenta-1,4-dienyl]benzoate.
| Compound Name | methyl 4-[(1E,4E)-5-[4-(2-hydroxyacetyl)phenyl]-3-oxopenta-1,4-dienyl]benzoate |
|---|---|
| PubChem CID | 90455248 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | methyl 4-[(1E,4E)-5-[4-(2-hydroxyacetyl)phenyl]-3-oxopenta-1,4-dienyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)/C=C/c2ccc(C(=O)CO)cc2)cc1 |
| InChI | InChI=1S/C21H18O5/c1-26-21(25)18-10-4-16(5-11-18)7-13-19(23)12-6-15-2-8-17(9-3-15)20(24)14-22/h2-13,22H,14H2,1H3/b12-6+,13-7+ |
| InChIKey | HCKSNUMSFHAYQU-PWHKKFIBSA-N |
| XLogP | 2.94 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|