C41H63N3O6 — CID 90456172
4-[di(propan-2-yl)amino]-2-phenyl-2-pyridin-2-ylbutanamide;7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 90456172) has the molecular formula C41H63N3O6 and a molecular weight of 693.97 g/mol. Its IUPAC name is 4-[di(propan-2-yl)amino]-2-phenyl-2-pyridin-2-ylbutanamide;7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 4-[di(propan-2-yl)amino]-2-phenyl-2-pyridin-2-ylbutanamide;7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 90456172 |
| Molecular Formula | C41H63N3O6 |
| Molecular Weight | 693.97 g/mol |
| Exact Mass | 693.47 |
| IUPAC Name | 4-[di(propan-2-yl)amino]-2-phenyl-2-pyridin-2-ylbutanamide;7-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | CC(C)N(CCC(C(N)=O)(c1ccccc1)c1ccccn1)C(C)C.CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C21H29N3O.C20H34O5/c1-16(2)24(17(3)4)15-13-21(20(22)25,18-10-6-5-7-11-18)19-12-8-9-14-23-19;1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h5-12,14,16-17H,13,15H2,1-4H3,(H2,22,25);12-13,15-17,19,21,23H,2-11,14H2,1H3,(H,24,25)/b;13-12+/t;15-,16+,17+,19+/m.0/s1 |
| InChIKey | SNSZVQVXEOPHSZ-MRNIWQJSSA-N |
| XLogP | 6.84 |
| TPSA | 154.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.97 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|