C19H23N3O — CID 90461802
1-methyl-9-(2-piperidin-1-ylethyl)-2H-pyrido[3,4-b]indol-7-one (PubChem CID 90461802) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-methyl-9-(2-piperidin-1-ylethyl)-2H-pyrido[3,4-b]indol-7-one.
| Compound Name | 1-methyl-9-(2-piperidin-1-ylethyl)-2H-pyrido[3,4-b]indol-7-one |
|---|---|
| PubChem CID | 90461802 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 1-methyl-9-(2-piperidin-1-ylethyl)-2H-pyrido[3,4-b]indol-7-one |
| SMILES | Cc1[nH]ccc2c3ccc(=O)cc3n(CCN3CCCCC3)c12 |
| InChI | InChI=1S/C19H23N3O/c1-14-19-17(7-8-20-14)16-6-5-15(23)13-18(16)22(19)12-11-21-9-3-2-4-10-21/h5-8,13,20H,2-4,9-12H2,1H3 |
| InChIKey | OVHZFQNLBGTTNY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |