C21H24N4O3 — CID 90462047
N-[(3R,4R)-4-methyl-1-(1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carbonyl)piperidin-3-yl]prop-2-enamide (PubChem CID 90462047) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[(3R,4R)-4-methyl-1-(1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carbonyl)piperidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4R)-4-methyl-1-(1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carbonyl)piperidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 90462047 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[(3R,4R)-4-methyl-1-(1-oxo-3,4-dihydro-2H-pyrazino[1,2-a]indole-7-carbonyl)piperidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CN(C(=O)c2ccc3cc4n(c3c2)CCNC4=O)CC[C@H]1C |
| InChI | InChI=1S/C21H24N4O3/c1-3-19(26)23-16-12-24(8-6-13(16)2)21(28)15-5-4-14-10-18-20(27)22-7-9-25(18)17(14)11-15/h3-5,10-11,13,16H,1,6-9,12H2,2H3,(H,22,27)(H,23,26)/t13-,16+/m1/s1 |
| InChIKey | OXVYBWMNPDBCJM-CJNGLKHVSA-N |
| XLogP | 1.54 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|