C25H32N2O3S — CID 90464187
N-(2-oxothiolan-3-yl)-5-[3-(2,2,3,3-tetramethylcyclopropanecarbonyl)indol-1-yl]pentanamide (PubChem CID 90464187) has the molecular formula C25H32N2O3S and a molecular weight of 440.61 g/mol. Its IUPAC name is N-(2-oxothiolan-3-yl)-5-[3-(2,2,3,3-tetramethylcyclopropanecarbonyl)indol-1-yl]pentanamide.
| Compound Name | N-(2-oxothiolan-3-yl)-5-[3-(2,2,3,3-tetramethylcyclopropanecarbonyl)indol-1-yl]pentanamide |
|---|---|
| PubChem CID | 90464187 |
| Molecular Formula | C25H32N2O3S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-(2-oxothiolan-3-yl)-5-[3-(2,2,3,3-tetramethylcyclopropanecarbonyl)indol-1-yl]pentanamide |
| SMILES | CC1(C)C(C(=O)c2cn(CCCCC(=O)NC3CCSC3=O)c3ccccc23)C1(C)C |
| InChI | InChI=1S/C25H32N2O3S/c1-24(2)22(25(24,3)4)21(29)17-15-27(19-10-6-5-9-16(17)19)13-8-7-11-20(28)26-18-12-14-31-23(18)30/h5-6,9-10,15,18,22H,7-8,11-14H2,1-4H3,(H,26,28) |
| InChIKey | WVVQDXNMKHCGNF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|