C21H28BrNO — CID 169435072
[1-(5-bromo-1,1,2,2,3,3,4,4,5,5-decadeuteriopentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone (PubChem CID 169435072) has the molecular formula C21H28BrNO and a molecular weight of 400.43 g/mol. Its IUPAC name is [1-(5-bromo-1,1,2,2,3,3,4,4,5,5-decadeuteriopentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone.
| Compound Name | [1-(5-bromo-1,1,2,2,3,3,4,4,5,5-decadeuteriopentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
|---|---|
| PubChem CID | 169435072 |
| Molecular Formula | C21H28BrNO |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | [1-(5-bromo-1,1,2,2,3,3,4,4,5,5-decadeuteriopentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
| SMILES | [2H]C([2H])(Br)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])n1cc(C(=O)C2C(C)(C)C2(C)C)c2ccccc21 |
| InChI | InChI=1S/C21H28BrNO/c1-20(2)19(21(20,3)4)18(24)16-14-23(13-9-5-8-12-22)17-11-7-6-10-15(16)17/h6-7,10-11,14,19H,5,8-9,12-13H2,1-4H3/i5D2,8D2,9D2,12D2,13D2 |
| InChIKey | HEWSXAZQMCDEMO-LMNHOEEKSA-N |
| XLogP | 6.07 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|