C13H10N2OS — CID 90467644
3-methoxy-6-phenyl-[1,2]thiazolo[4,3-b]pyridine (PubChem CID 90467644) has the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. Its IUPAC name is 3-methoxy-6-phenyl-[1,2]thiazolo[4,3-b]pyridine.
| Compound Name | 3-methoxy-6-phenyl-[1,2]thiazolo[4,3-b]pyridine |
|---|---|
| PubChem CID | 90467644 |
| Molecular Formula | C13H10N2OS |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 3-methoxy-6-phenyl-[1,2]thiazolo[4,3-b]pyridine |
| SMILES | COc1snc2cc(-c3ccccc3)cnc12 |
| InChI | InChI=1S/C13H10N2OS/c1-16-13-12-11(15-17-13)7-10(8-14-12)9-5-3-2-4-6-9/h2-8H,1H3 |
| InChIKey | ZGRUFHJUXQKHDB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |