C19H19N3O4S — CID 90467920
[2-methoxy-4-(3-morpholin-4-yl-[1,2]thiazolo[4,3-b]pyridin-6-yl)phenyl] acetate (PubChem CID 90467920) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is [2-methoxy-4-(3-morpholin-4-yl-[1,2]thiazolo[4,3-b]pyridin-6-yl)phenyl] acetate.
| Compound Name | [2-methoxy-4-(3-morpholin-4-yl-[1,2]thiazolo[4,3-b]pyridin-6-yl)phenyl] acetate |
|---|---|
| PubChem CID | 90467920 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | [2-methoxy-4-(3-morpholin-4-yl-[1,2]thiazolo[4,3-b]pyridin-6-yl)phenyl] acetate |
| SMILES | COc1cc(-c2cnc3c(N4CCOCC4)snc3c2)ccc1OC(C)=O |
| InChI | InChI=1S/C19H19N3O4S/c1-12(23)26-16-4-3-13(10-17(16)24-2)14-9-15-18(20-11-14)19(27-21-15)22-5-7-25-8-6-22/h3-4,9-11H,5-8H2,1-2H3 |
| InChIKey | RCQXJORNFIJQQR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|