C26H28N2O3S — CID 90468597
3-(4-tert-butyl-1,3-benzothiazol-2-yl)-7-hydroxy-8-(piperidin-1-ylmethyl)chromen-4-one (PubChem CID 90468597) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is 3-(4-tert-butyl-1,3-benzothiazol-2-yl)-7-hydroxy-8-(piperidin-1-ylmethyl)chromen-4-one.
| Compound Name | 3-(4-tert-butyl-1,3-benzothiazol-2-yl)-7-hydroxy-8-(piperidin-1-ylmethyl)chromen-4-one |
|---|---|
| PubChem CID | 90468597 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 3-(4-tert-butyl-1,3-benzothiazol-2-yl)-7-hydroxy-8-(piperidin-1-ylmethyl)chromen-4-one |
| SMILES | CC(C)(C)c1cccc2sc(-c3coc4c(CN5CCCCC5)c(O)ccc4c3=O)nc12 |
| InChI | InChI=1S/C26H28N2O3S/c1-26(2,3)19-8-7-9-21-22(19)27-25(32-21)18-15-31-24-16(23(18)30)10-11-20(29)17(24)14-28-12-5-4-6-13-28/h7-11,15,29H,4-6,12-14H2,1-3H3 |
| InChIKey | CBOLRKZYRUOFGC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|