C13H16O4 — CID 90471500
methyl 1,3-dimethyl-5-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-ene-10-carboxylate (PubChem CID 90471500) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is methyl 1,3-dimethyl-5-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-ene-10-carboxylate.
| Compound Name | methyl 1,3-dimethyl-5-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-ene-10-carboxylate |
|---|---|
| PubChem CID | 90471500 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | methyl 1,3-dimethyl-5-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-ene-10-carboxylate |
| SMILES | COC(=O)C1C2C(=O)OC3(C)CC1(C)C=CC23 |
| InChI | InChI=1S/C13H16O4/c1-12-5-4-7-8(9(12)11(15)16-3)10(14)17-13(7,2)6-12/h4-5,7-9H,6H2,1-3H3 |
| InChIKey | ZYKNFZCGGOVHDL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|