C13H18O3 — CID 10680546
methyl (1R,2S,5S,6R,7S)-1,2,5-trimethyl-4-oxotricyclo[3.2.1.02,7]octane-6-carboxylate (PubChem CID 10680546) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is methyl (1R,2S,5S,6R,7S)-1,2,5-trimethyl-4-oxotricyclo[3.2.1.02,7]octane-6-carboxylate.
| Compound Name | methyl (1R,2S,5S,6R,7S)-1,2,5-trimethyl-4-oxotricyclo[3.2.1.02,7]octane-6-carboxylate |
|---|---|
| PubChem CID | 10680546 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | methyl (1R,2S,5S,6R,7S)-1,2,5-trimethyl-4-oxotricyclo[3.2.1.02,7]octane-6-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2[C@]3(C)CC(=O)[C@@]1(C)C[C@]23C |
| InChI | InChI=1S/C13H18O3/c1-11-6-13(3)9(8(11)10(15)16-4)12(13,2)5-7(11)14/h8-9H,5-6H2,1-4H3/t8-,9+,11+,12-,13+/m0/s1 |
| InChIKey | UMNJMQJSSCUCAA-NELYUFSOSA-N |
| XLogP | 1.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |