C17H26O3 — CID 177482417
methyl (2S,7R,8S,9R)-2,6,6,9-tetramethyl-11-oxotricyclo[5.4.0.02,9]undecane-8-carboxylate (PubChem CID 177482417) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is methyl (2S,7R,8S,9R)-2,6,6,9-tetramethyl-11-oxotricyclo[5.4.0.02,9]undecane-8-carboxylate.
| Compound Name | methyl (2S,7R,8S,9R)-2,6,6,9-tetramethyl-11-oxotricyclo[5.4.0.02,9]undecane-8-carboxylate |
|---|---|
| PubChem CID | 177482417 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | methyl (2S,7R,8S,9R)-2,6,6,9-tetramethyl-11-oxotricyclo[5.4.0.02,9]undecane-8-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2C3C(=O)C[C@@]1(C)[C@@]3(C)CCCC2(C)C |
| InChI | InChI=1S/C17H26O3/c1-15(2)7-6-8-16(3)11-10(18)9-17(16,4)13(12(11)15)14(19)20-5/h11-13H,6-9H2,1-5H3/t11?,12-,13-,16+,17-/m1/s1 |
| InChIKey | JIGFVJIURWAQOU-LKIRTGRHSA-N |
| XLogP | 3.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |