C36H62NO2- — CID 90473637
N-[3-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]octyl]carbamate (PubChem CID 90473637) has the molecular formula C36H62NO2- and a molecular weight of 540.90 g/mol. Its IUPAC name is N-[3-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]octyl]carbamate.
| Compound Name | N-[3-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]octyl]carbamate |
|---|---|
| PubChem CID | 90473637 |
| Molecular Formula | C36H62NO2- |
| Molecular Weight | 540.90 g/mol |
| Exact Mass | 540.48 |
| IUPAC Name | N-[3-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]octyl]carbamate |
| SMILES | CCCCCC(CCNC(=O)[O-])C1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCCC(C)C)C1 |
| InChI | InChI=1S/C36H63NO2/c1-7-8-9-13-27(20-23-37-34(38)39)28-18-21-35(5)29(24-28)14-15-30-32-17-16-31(26(4)12-10-11-25(2)3)36(32,6)22-19-33(30)35/h14,25-28,30-33,37H,7-13,15-24H2,1-6H3,(H,38,39)/p-1/t26-,27?,28?,30?,31-,32?,33?,35+,36-/m1/s1 |
| InChIKey | AFEGMXNPILAPBO-HDMYKGBESA-M |
| XLogP | 9.16 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.90 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|