C34H57ClOS — CID 124904014
S-[(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-chloroheptanethioate (PubChem CID 124904014) has the molecular formula C34H57ClOS and a molecular weight of 549.35 g/mol. Its IUPAC name is S-[(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-chloroheptanethioate.
| Compound Name | S-[(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-chloroheptanethioate |
|---|---|
| PubChem CID | 124904014 |
| Molecular Formula | C34H57ClOS |
| Molecular Weight | 549.35 g/mol |
| Exact Mass | 548.38 |
| IUPAC Name | S-[(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2R)-2-chloroheptanethioate |
| SMILES | CCCCC[C@@H](Cl)C(=O)S[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@H]4CC[C@@H]([C@@H](C)CCCC(C)C)[C@@]4(C)CC[C@H]32)C1 |
| InChI | InChI=1S/C34H57ClOS/c1-7-8-9-13-31(35)32(36)37-26-18-20-33(5)25(22-26)14-15-27-29-17-16-28(24(4)12-10-11-23(2)3)34(29,6)21-19-30(27)33/h14,23-24,26-31H,7-13,15-22H2,1-6H3/t24-,26-,27+,28-,29+,30+,31+,33-,34+/m0/s1 |
| InChIKey | OUFIJZVLVZAQTQ-COCZNXNJSA-N |
| XLogP | 10.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.35 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|