C37H56O2S — CID 124904576
S-[(3S,8S,9S,10R,13R,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-phenoxybutanethioate (PubChem CID 124904576) has the molecular formula C37H56O2S and a molecular weight of 564.92 g/mol. Its IUPAC name is S-[(3S,8S,9S,10R,13R,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-phenoxybutanethioate.
| Compound Name | S-[(3S,8S,9S,10R,13R,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-phenoxybutanethioate |
|---|---|
| PubChem CID | 124904576 |
| Molecular Formula | C37H56O2S |
| Molecular Weight | 564.92 g/mol |
| Exact Mass | 564.40 |
| IUPAC Name | S-[(3S,8S,9S,10R,13R,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-phenoxybutanethioate |
| SMILES | CC[C@H](Oc1ccccc1)C(=O)S[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@H]4CC[C@@H]([C@@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C37H56O2S/c1-7-34(39-28-14-9-8-10-15-28)35(38)40-29-20-22-36(5)27(24-29)16-17-30-32-19-18-31(26(4)13-11-12-25(2)3)37(32,6)23-21-33(30)36/h8-10,14-16,25-26,29-34H,7,11-13,17-24H2,1-6H3/t26-,29-,30-,31-,32+,33-,34-,36-,37+/m0/s1 |
| InChIKey | YEWJETVSCUWSGT-JJTXBGKASA-N |
| XLogP | 10.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.92 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|