C14H18O5 — CID 90473744
3-acetyl-5-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-4-methoxy-5-methylfuran-2-one (PubChem CID 90473744) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 3-acetyl-5-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-4-methoxy-5-methylfuran-2-one.
| Compound Name | 3-acetyl-5-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-4-methoxy-5-methylfuran-2-one |
|---|---|
| PubChem CID | 90473744 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-acetyl-5-[(1E,3E)-5-hydroxyhexa-1,3-dienyl]-4-methoxy-5-methylfuran-2-one |
| SMILES | COC1=C(C(C)=O)C(=O)OC1(C)/C=C/C=C/C(C)O |
| InChI | InChI=1S/C14H18O5/c1-9(15)7-5-6-8-14(3)12(18-4)11(10(2)16)13(17)19-14/h5-9,15H,1-4H3/b7-5+,8-6+ |
| InChIKey | MHFSYGXKTKAWDK-KQQUZDAGSA-N |
| XLogP | 1.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|