About butyl 5-cyanooctan-4-yl hydrogen phosphate
butyl 5-cyanooctan-4-yl hydrogen phosphate (PubChem CID 90475734) has the molecular formula C13H26NO4P
and a molecular weight of 291.33 g/mol. Its IUPAC name is butyl 5-cyanooctan-4-yl hydrogen phosphate.
Molecular Properties
| Compound Name | butyl 5-cyanooctan-4-yl hydrogen phosphate |
| PubChem CID | 90475734 |
| Molecular Formula | C13H26NO4P |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | butyl 5-cyanooctan-4-yl hydrogen phosphate |
| SMILES | CCCCOP(=O)(O)OC(CCC)C(C#N)CCC |
| InChI | InChI=1S/C13H26NO4P/c1-4-7-10-17-19(15,16)18-13(9-6-3)12(11-14)8-5-2/h12-13H,4-10H2,1-3H3,(H,15,16) |
| InChIKey | DAPKYBYPXBUDNZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butyl 5-cyanooctan-4-yl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 5-cyanooctan-4-yl hydrogen phosphate?
The IUPAC name of butyl 5-cyanooctan-4-yl hydrogen phosphate (CID 90475734) is butyl 5-cyanooctan-4-yl hydrogen phosphate.
What is the SMILES notation for butyl 5-cyanooctan-4-yl hydrogen phosphate?
The canonical SMILES for butyl 5-cyanooctan-4-yl hydrogen phosphate is CCCCOP(=O)(O)OC(CCC)C(C#N)CCC.
What is the InChIKey of butyl 5-cyanooctan-4-yl hydrogen phosphate?
The InChIKey is DAPKYBYPXBUDNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26NO4P/c1-4-7-10-17-19(15,16)18-13(9-6-3)12(11-14)8-5-2/h12-13H,4-10H2,1-3H3,(H,15,16).
What are the key properties of butyl 5-cyanooctan-4-yl hydrogen phosphate?
butyl 5-cyanooctan-4-yl hydrogen phosphate has a molecular weight of 291.33 g/mol, XLogP of 4.03, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 5-cyanooctan-4-yl hydrogen phosphate is sourced from PubChem (CID 90475734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).