C16H23N5O4S — CID 90475879
(1-methylindol-3-yl)-(1,2,3-trimethyl-1,5-dihydropyrazol-1-ium-5-yl)diazene;methyl sulfate (PubChem CID 90475879) has the molecular formula C16H23N5O4S and a molecular weight of 381.46 g/mol. Its IUPAC name is (1-methylindol-3-yl)-(1,2,3-trimethyl-1,5-dihydropyrazol-1-ium-5-yl)diazene;methyl sulfate.
| Compound Name | (1-methylindol-3-yl)-(1,2,3-trimethyl-1,5-dihydropyrazol-1-ium-5-yl)diazene;methyl sulfate |
|---|---|
| PubChem CID | 90475879 |
| Molecular Formula | C16H23N5O4S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (1-methylindol-3-yl)-(1,2,3-trimethyl-1,5-dihydropyrazol-1-ium-5-yl)diazene;methyl sulfate |
| SMILES | CC1=CC(/N=N/c2cn(C)c3ccccc23)[NH+](C)N1C.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C15H19N5.CH4O4S/c1-11-9-15(20(4)19(11)3)17-16-13-10-18(2)14-8-6-5-7-12(13)14;1-5-6(2,3)4/h5-10,15H,1-4H3;1H3,(H,2,3,4)/b17-16+; |
| InChIKey | WCDCYBROXMHBIS-CMBBICFISA-N |
| XLogP | 0.96 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|