About hydroxy-[(4-nitrophenyl)methoxy]-oxo-selanylidene-λ6-sulfane
hydroxy-[(4-nitrophenyl)methoxy]-oxo-selanylidene-λ6-sulfane (PubChem CID 90477499) has the molecular formula C7H7NO5SSe
and a molecular weight of 296.16 g/mol. Its IUPAC name is hydroxy-[(4-nitrophenyl)methoxy]-oxo-selanylidene-λ6-sulfane.
Molecular Properties
| Compound Name | hydroxy-[(4-nitrophenyl)methoxy]-oxo-selanylidene-λ6-sulfane |
| PubChem CID | 90477499 |
| Molecular Formula | C7H7NO5SSe |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 296.92 |
| IUPAC Name | hydroxy-[(4-nitrophenyl)methoxy]-oxo-selanylidene-λ6-sulfane |
| SMILES | O=[N+]([O-])c1ccc(COS(=O)(O)=[Se])cc1 |
| InChI | InChI=1S/C7H7NO5SSe/c9-8(10)7-3-1-6(2-4-7)5-13-14(11,12)15/h1-4H,5H2,(H,11,12,15) |
| InChIKey | NCAKPVAOYLFWJC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-[(4-nitrophenyl)methoxy]-oxo-selanylidene-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-[(4-nitrophenyl)methoxy]-oxo-selanylidene-λ6-sulfane?
The IUPAC name of hydroxy-[(4-nitrophenyl)methoxy]-oxo-selanylidene-λ6-sulfane (CID 90477499) is hydroxy-[(4-nitrophenyl)methoxy]-oxo-selanylidene-λ6-sulfane.
What is the SMILES notation for hydroxy-[(4-nitrophenyl)methoxy]-oxo-selanylidene-λ6-sulfane?
The canonical SMILES for hydroxy-[(4-nitrophenyl)methoxy]-oxo-selanylidene-λ6-sulfane is O=[N+]([O-])c1ccc(COS(=O)(O)=[Se])cc1.
What is the InChIKey of hydroxy-[(4-nitrophenyl)methoxy]-oxo-selanylidene-λ6-sulfane?
The InChIKey is NCAKPVAOYLFWJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO5SSe/c9-8(10)7-3-1-6(2-4-7)5-13-14(11,12)15/h1-4H,5H2,(H,11,12,15).
What are the key properties of hydroxy-[(4-nitrophenyl)methoxy]-oxo-selanylidene-λ6-sulfane?
hydroxy-[(4-nitrophenyl)methoxy]-oxo-selanylidene-λ6-sulfane has a molecular weight of 296.16 g/mol, XLogP of 0.87, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-[(4-nitrophenyl)methoxy]-oxo-selanylidene-λ6-sulfane is sourced from PubChem (CID 90477499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).