About Cycloguanil hydrochloride
Cycloguanil hydrochloride (PubChem CID 9048) has the molecular formula C11H15Cl2N5
and a molecular weight of 288.17 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | Cycloguanil hydrochloride |
| PubChem CID | 9048 |
| Molecular Formula | C11H15Cl2N5 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-(4-chlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrochloride |
| SMILES | CC1(N=C(N=C(N1C2=CC=C(C=C2)Cl)N)N)C.Cl |
| InChI | InChI=1S/C11H14ClN5.ClH/c1-11(2)16-9(13)15-10(14)17(11)8-5-3-7(12)4-6-8;/h3-6H,1-2H3,(H4,13,14,15,16);1H |
| InChIKey | MOUAPRKJJUXEIE-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 80.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | 355 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Cycloguanil hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cycloguanil hydrochloride?
The IUPAC name of Cycloguanil hydrochloride (CID 9048) is 1-(4-chlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine;hydrochloride.
What is the SMILES notation for Cycloguanil hydrochloride?
The canonical SMILES for Cycloguanil hydrochloride is CC1(N=C(N=C(N1C2=CC=C(C=C2)Cl)N)N)C.Cl.
What is the InChIKey of Cycloguanil hydrochloride?
The InChIKey is MOUAPRKJJUXEIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN5.ClH/c1-11(2)16-9(13)15-10(14)17(11)8-5-3-7(12)4-6-8;/h3-6H,1-2H3,(H4,13,14,15,16);1H.
What are the key properties of Cycloguanil hydrochloride?
Cycloguanil hydrochloride has a molecular weight of 288.17 g/mol, XLogP of not available, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Cycloguanil hydrochloride is sourced from PubChem (CID 9048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).