C11H14ClN5 — CID 9049
View drug profile → cycloguanil1-(4-chlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 9049) has the molecular formula C11H14ClN5 and a molecular weight of 251.72 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 1-(4-chlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 9049 |
| Molecular Formula | C11H14ClN5 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 1-(4-chlorophenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CC1(C)N=C(N)N=C(N)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H14ClN5/c1-11(2)16-9(13)15-10(14)17(11)8-5-3-7(12)4-6-8/h3-6H,1-2H3,(H4,13,14,15,16) |
| InChIKey | QMNFFXRFOJIOKZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |