C17H18FNO2S — CID 90481095
(E)-N-(4-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethenesulfonamide (PubChem CID 90481095) has the molecular formula C17H18FNO2S and a molecular weight of 319.40 g/mol. Its IUPAC name is (E)-N-(4-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethenesulfonamide.
| Compound Name | (E)-N-(4-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 90481095 |
| Molecular Formula | C17H18FNO2S |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (E)-N-(4-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethenesulfonamide |
| SMILES | Cc1cc(C)c(/C=C/S(=O)(=O)Nc2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C17H18FNO2S/c1-12-10-13(2)17(14(3)11-12)8-9-22(20,21)19-16-6-4-15(18)5-7-16/h4-11,19H,1-3H3/b9-8+ |
| InChIKey | UTQCXTKAXYYGKJ-CMDGGOBGSA-N |
| XLogP | 4.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |