C14H10F3NO2S — CID 57148024
N-phenyl-2-(2,4,6-trifluorophenyl)ethenesulfonamide (PubChem CID 57148024) has the molecular formula C14H10F3NO2S and a molecular weight of 313.30 g/mol. Its IUPAC name is N-phenyl-2-(2,4,6-trifluorophenyl)ethenesulfonamide.
| Compound Name | N-phenyl-2-(2,4,6-trifluorophenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 57148024 |
| Molecular Formula | C14H10F3NO2S |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | N-phenyl-2-(2,4,6-trifluorophenyl)ethenesulfonamide |
| SMILES | O=S(=O)(C=Cc1c(F)cc(F)cc1F)Nc1ccccc1 |
| InChI | InChI=1S/C14H10F3NO2S/c15-10-8-13(16)12(14(17)9-10)6-7-21(19,20)18-11-4-2-1-3-5-11/h1-9,18H |
| InChIKey | CCGRJNFWUBECAZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |