C17H12 — CID 90482120
7,7-dideuteriobenzo[c]fluorene (PubChem CID 90482120) has the molecular formula C17H12 and a molecular weight of 218.30 g/mol. Its IUPAC name is 7,7-dideuteriobenzo[c]fluorene.
| Compound Name | 7,7-dideuteriobenzo[c]fluorene |
|---|---|
| PubChem CID | 90482120 |
| Molecular Formula | C17H12 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 7,7-dideuteriobenzo[c]fluorene |
| SMILES | [2H]C1([2H])c2ccccc2-c2c1ccc1ccccc21 |
| InChI | InChI=1S/C17H12/c1-3-7-15-12(5-1)9-10-14-11-13-6-2-4-8-16(13)17(14)15/h1-10H,11H2/i11D2 |
| InChIKey | FRIJWEQBTIZQMD-ZWGOZCLVSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |