methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate

C14H13ClO2 — CID 90487780

IUPACmethyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate
SMILESCOC(=O)c1cc(Cl)c2ccc(C)c(C)c2c1
InChIInChI=1S/C14H13ClO2/c1-8-4-5-11-12(9(8)2)6-10(7-13(11)15)14(16)17-3/h4-7H,1-3H3
InChIKeyKMHTXGJKZCPNBB-UHFFFAOYSA-N
MW248.71 g/mol
LogP3.90
Rot. Bonds1

About methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate

methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate (PubChem CID 90487780) has the molecular formula C14H13ClO2 and a molecular weight of 248.71 g/mol. Its IUPAC name is methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate.

Molecular Properties

Compound Namemethyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate
PubChem CID90487780
Molecular FormulaC14H13ClO2
Molecular Weight248.71 g/mol
Exact Mass248.06
IUPAC Namemethyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate
SMILESCOC(=O)c1cc(Cl)c2ccc(C)c(C)c2c1
InChIInChI=1S/C14H13ClO2/c1-8-4-5-11-12(9(8)2)6-10(7-13(11)15)14(16)17-3/h4-7H,1-3H3
InChIKeyKMHTXGJKZCPNBB-UHFFFAOYSA-N
XLogP3.90
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.71
LogP ≤ 53.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate?
The IUPAC name of methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate (CID 90487780) is methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate.
What is the SMILES notation for methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate?
The canonical SMILES for methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate is COC(=O)c1cc(Cl)c2ccc(C)c(C)c2c1.
What is the InChIKey of methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate?
The InChIKey is KMHTXGJKZCPNBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClO2/c1-8-4-5-11-12(9(8)2)6-10(7-13(11)15)14(16)17-3/h4-7H,1-3H3.
What are the key properties of methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate?
methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate has a molecular weight of 248.71 g/mol, XLogP of 3.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate is sourced from PubChem (CID 90487780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).