C14H13ClO2 — CID 90487780
methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate (PubChem CID 90487780) has the molecular formula C14H13ClO2 and a molecular weight of 248.71 g/mol. Its IUPAC name is methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate.
| Compound Name | methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 90487780 |
| Molecular Formula | C14H13ClO2 |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | methyl 4-chloro-7,8-dimethylnaphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc(Cl)c2ccc(C)c(C)c2c1 |
| InChI | InChI=1S/C14H13ClO2/c1-8-4-5-11-12(9(8)2)6-10(7-13(11)15)14(16)17-3/h4-7H,1-3H3 |
| InChIKey | KMHTXGJKZCPNBB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |