C18H14FN3O — CID 90489194
5-fluoro-N-(1H-indol-6-yl)-1-methylindole-2-carboxamide (PubChem CID 90489194) has the molecular formula C18H14FN3O and a molecular weight of 307.33 g/mol. Its IUPAC name is 5-fluoro-N-(1H-indol-6-yl)-1-methylindole-2-carboxamide.
| Compound Name | 5-fluoro-N-(1H-indol-6-yl)-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 90489194 |
| Molecular Formula | C18H14FN3O |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 5-fluoro-N-(1H-indol-6-yl)-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccc3cc[nH]c3c2)cc2cc(F)ccc21 |
| InChI | InChI=1S/C18H14FN3O/c1-22-16-5-3-13(19)8-12(16)9-17(22)18(23)21-14-4-2-11-6-7-20-15(11)10-14/h2-10,20H,1H3,(H,21,23) |
| InChIKey | KBLZTFPDEYOASQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |