C25H30N4O4S — CID 90490247
N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-4-(diethylsulfamoyl)benzamide (PubChem CID 90490247) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-4-(diethylsulfamoyl)benzamide.
| Compound Name | N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-4-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 90490247 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-4-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCc2nn(C3CCCC3)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H30N4O4S/c1-3-28(4-2)34(32,33)20-15-13-18(14-16-20)24(30)26-17-23-21-11-7-8-12-22(21)25(31)29(27-23)19-9-5-6-10-19/h7-8,11-16,19H,3-6,9-10,17H2,1-2H3,(H,26,30) |
| InChIKey | AVMYVVLDDOWDGL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |