C24H27N3O5 — CID 71779529
N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-3,4,5-trimethoxybenzamide (PubChem CID 71779529) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 71779529 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCc2nn(C3CCCC3)c(=O)c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C24H27N3O5/c1-30-20-12-15(13-21(31-2)22(20)32-3)23(28)25-14-19-17-10-6-7-11-18(17)24(29)27(26-19)16-8-4-5-9-16/h6-7,10-13,16H,4-5,8-9,14H2,1-3H3,(H,25,28) |
| InChIKey | HODQSZLVWXTVBX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |