C26H29N3O5 — CID 90490216
(E)-N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 90490216) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is (E)-N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90490216 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | (E)-N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCc2nn(C3CCCC3)c(=O)c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C26H29N3O5/c1-32-22-14-17(15-23(33-2)25(22)34-3)12-13-24(30)27-16-21-19-10-6-7-11-20(19)26(31)29(28-21)18-8-4-5-9-18/h6-7,10-15,18H,4-5,8-9,16H2,1-3H3,(H,27,30)/b13-12+ |
| InChIKey | QXWCGXDWHHWSOB-OUKQBFOZSA-N |
| XLogP | 3.87 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|