C22H23N5O2S — CID 90490687
3-[4-[(E)-2-(4-methylphenyl)ethenyl]sulfonylpiperazin-1-yl]-6-pyridin-2-ylpyridazine (PubChem CID 90490687) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is 3-[4-[(E)-2-(4-methylphenyl)ethenyl]sulfonylpiperazin-1-yl]-6-pyridin-2-ylpyridazine.
| Compound Name | 3-[4-[(E)-2-(4-methylphenyl)ethenyl]sulfonylpiperazin-1-yl]-6-pyridin-2-ylpyridazine |
|---|---|
| PubChem CID | 90490687 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3-[4-[(E)-2-(4-methylphenyl)ethenyl]sulfonylpiperazin-1-yl]-6-pyridin-2-ylpyridazine |
| SMILES | Cc1ccc(/C=C/S(=O)(=O)N2CCN(c3ccc(-c4ccccn4)nn3)CC2)cc1 |
| InChI | InChI=1S/C22H23N5O2S/c1-18-5-7-19(8-6-18)11-17-30(28,29)27-15-13-26(14-16-27)22-10-9-21(24-25-22)20-4-2-3-12-23-20/h2-12,17H,13-16H2,1H3/b17-11+ |
| InChIKey | VUSTZVNFVBLENS-GZTJUZNOSA-N |
| XLogP | 2.97 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |