C19H23N5O2 — CID 90491282
cyclohex-3-en-1-yl-[4-[5-(5-methyl-1,2,4-oxadiazol-3-yl)-2-pyridinyl]piperazin-1-yl]methanone (PubChem CID 90491282) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is cyclohex-3-en-1-yl-[4-[5-(5-methyl-1,2,4-oxadiazol-3-yl)-2-pyridinyl]piperazin-1-yl]methanone.
| Compound Name | cyclohex-3-en-1-yl-[4-[5-(5-methyl-1,2,4-oxadiazol-3-yl)-2-pyridinyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 90491282 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | cyclohex-3-en-1-yl-[4-[5-(5-methyl-1,2,4-oxadiazol-3-yl)-2-pyridinyl]piperazin-1-yl]methanone |
| SMILES | Cc1nc(-c2ccc(N3CCN(C(=O)C4CC=CCC4)CC3)nc2)no1 |
| InChI | InChI=1S/C19H23N5O2/c1-14-21-18(22-26-14)16-7-8-17(20-13-16)23-9-11-24(12-10-23)19(25)15-5-3-2-4-6-15/h2-3,7-8,13,15H,4-6,9-12H2,1H3 |
| InChIKey | ARKURYPWOVGJDH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|