C18H31N3O2S — CID 90494392
1-cyclohexylsulfonyl-4-[(2-propan-2-ylimidazol-1-yl)methyl]piperidine (PubChem CID 90494392) has the molecular formula C18H31N3O2S and a molecular weight of 353.53 g/mol. Its IUPAC name is 1-cyclohexylsulfonyl-4-[(2-propan-2-ylimidazol-1-yl)methyl]piperidine.
| Compound Name | 1-cyclohexylsulfonyl-4-[(2-propan-2-ylimidazol-1-yl)methyl]piperidine |
|---|---|
| PubChem CID | 90494392 |
| Molecular Formula | C18H31N3O2S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-cyclohexylsulfonyl-4-[(2-propan-2-ylimidazol-1-yl)methyl]piperidine |
| SMILES | CC(C)c1nccn1CC1CCN(S(=O)(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C18H31N3O2S/c1-15(2)18-19-10-13-20(18)14-16-8-11-21(12-9-16)24(22,23)17-6-4-3-5-7-17/h10,13,15-17H,3-9,11-12,14H2,1-2H3 |
| InChIKey | BVFDIXWQORXMKE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |