C14H25N3O2S — CID 125435168
1-cyclopentyl-N-[(1S)-2-methyl-1-(1-methylimidazol-2-yl)propyl]methanesulfonamide (PubChem CID 125435168) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-cyclopentyl-N-[(1S)-2-methyl-1-(1-methylimidazol-2-yl)propyl]methanesulfonamide.
| Compound Name | 1-cyclopentyl-N-[(1S)-2-methyl-1-(1-methylimidazol-2-yl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 125435168 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-cyclopentyl-N-[(1S)-2-methyl-1-(1-methylimidazol-2-yl)propyl]methanesulfonamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)CC1CCCC1)c1nccn1C |
| InChI | InChI=1S/C14H25N3O2S/c1-11(2)13(14-15-8-9-17(14)3)16-20(18,19)10-12-6-4-5-7-12/h8-9,11-13,16H,4-7,10H2,1-3H3/t13-/m0/s1 |
| InChIKey | NDEIOAINZLROLO-ZDUSSCGKSA-N |
| XLogP | 2.23 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |