C20H20ClN3O4 — CID 90498404
N'-(5-chloro-2-cyanophenyl)-N-[2-hydroxy-3-(4-methoxyphenyl)-2-methylpropyl]oxamide (PubChem CID 90498404) has the molecular formula C20H20ClN3O4 and a molecular weight of 401.85 g/mol. Its IUPAC name is N'-(5-chloro-2-cyanophenyl)-N-[2-hydroxy-3-(4-methoxyphenyl)-2-methylpropyl]oxamide.
| Compound Name | N'-(5-chloro-2-cyanophenyl)-N-[2-hydroxy-3-(4-methoxyphenyl)-2-methylpropyl]oxamide |
|---|---|
| PubChem CID | 90498404 |
| Molecular Formula | C20H20ClN3O4 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N'-(5-chloro-2-cyanophenyl)-N-[2-hydroxy-3-(4-methoxyphenyl)-2-methylpropyl]oxamide |
| SMILES | COc1ccc(CC(C)(O)CNC(=O)C(=O)Nc2cc(Cl)ccc2C#N)cc1 |
| InChI | InChI=1S/C20H20ClN3O4/c1-20(27,10-13-3-7-16(28-2)8-4-13)12-23-18(25)19(26)24-17-9-15(21)6-5-14(17)11-22/h3-9,27H,10,12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | UEWXALTZNHEMSH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|