C14H19ClN2O4S — CID 90523224
N'-(5-chloro-2-methoxyphenyl)-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)oxamide (PubChem CID 90523224) has the molecular formula C14H19ClN2O4S and a molecular weight of 346.84 g/mol. Its IUPAC name is N'-(5-chloro-2-methoxyphenyl)-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)oxamide.
| Compound Name | N'-(5-chloro-2-methoxyphenyl)-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)oxamide |
|---|---|
| PubChem CID | 90523224 |
| Molecular Formula | C14H19ClN2O4S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N'-(5-chloro-2-methoxyphenyl)-N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)oxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(=O)NCC(C)(O)CSC |
| InChI | InChI=1S/C14H19ClN2O4S/c1-14(20,8-22-3)7-16-12(18)13(19)17-10-6-9(15)4-5-11(10)21-2/h4-6,20H,7-8H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | LSMSHZVWJGBYCQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|